EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3S |
| Net Charge | 0 |
| Average Mass | 177.225 |
| Monoisotopic Mass | 177.04596 |
| SMILES | C=CCS(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11?/m0/s1 |
| InChIKey | XUHLIQGRKRUKPH-ITZCMCNPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(Allylsulphinyl)-L-alanine (CHEBI:182413) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-prop-2-enylsulinylpropanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:17795-26-5 | ChemIDplus |