EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O7 |
| Net Charge | 0 |
| Average Mass | 294.259 |
| Monoisotopic Mass | 294.07395 |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)CCC21OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H14O7/c15-9-3-4-14(11(17)10(16)13(20)21-14)8-2-1-6(12(18)19)5-7(8)9/h1-2,5,10-11,13,16-17,20H,3-4H2,(H,18,19)/t10-,11+,13?,14?/m1/s1 |
| InChIKey | BAUPPZJHTWBQAS-UJLSLHKQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3'S,4'R)-3',4',5'-Trihydroxy-8-oxospiro[6,7-dihydronaphthalene-5,2'-oxolane]-2-carboxylic acid (CHEBI:182408) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| (3'S,4'R)-3',4',5'-trihydroxy-8-oxospiro[6,7-dihydronaphthalene-5,2'-oxolane]-2-carboxylic acid |