EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O8 |
| Net Charge | 0 |
| Average Mass | 278.217 |
| Monoisotopic Mass | 278.07502 |
| SMILES | N[C@@H](CNC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O8/c10-4(7(15)16)3-11-5(12)1-9(19,8(17)18)2-6(13)14/h4,19H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t4-,9?/m0/s1 |
| InChIKey | RACKNMPLNJKJHK-HBSVBABPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(L-Alanin-3-ylcarbamoyl)methyl]-2-hydroxybutanedioate (CHEBI:182406) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| 2-[2-[[(2S)-2-amino-2-carboxyethyl]amino]-2-oxoethyl]-2-hydroxybutanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C22072 | KEGG COMPOUND |