EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO4 |
| Net Charge | 0 |
| Average Mass | 281.352 |
| Monoisotopic Mass | 281.16271 |
| SMILES | CC1C/C(=C\CC(CC(N)=O)CC(=O)O)C(=O)C(C)C1 |
| InChI | InChI=1S/C15H23NO4/c1-9-5-10(2)15(20)12(6-9)4-3-11(7-13(16)17)8-14(18)19/h4,9-11H,3,5-8H2,1-2H3,(H2,16,17)(H,18,19)/b12-4+ |
| InChIKey | VUHCEJPYCQSKEW-UUILKARUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Amino-3-[(2E)-2-(3,5-dimethyl-2-oxocyclohexylidene)ethyl]-5-oxopentanoic acid (CHEBI:182225) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-amino-3-[(2E)-2-(3,5-dimethyl-2-oxocyclohexylidene)ethyl]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 22842389 | ChemSpider |