EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O4 |
| Net Charge | 0 |
| Average Mass | 314.381 |
| Monoisotopic Mass | 314.15181 |
| SMILES | O=C(CCc1ccc(O)cc1)CC(O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H22O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-4,7-10,18,20-22H,5-6,11-13H2 |
| InChIKey | ZBFSUZGUYFFWGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-one (CHEBI:182210) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 29813997 | ChemSpider |