EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:182183 - 6-Fluoro-DL-tryptophan
| Formula | C11H11FN2O2 |
| Net Charge | 0 |
| Average Mass | 222.219 |
| Monoisotopic Mass | 222.08046 |
| SMILES | NC(Cc1cnc2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C11H11FN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16) |
| InChIKey | YMEXGEAJNZRQEH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Fluoro-DL-tryptophan (CHEBI:182183) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-amino-3-(6-luoro-1H-indol-3-yl)propanoic acid |