EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29NO2 |
| Net Charge | 0 |
| Average Mass | 267.413 |
| Monoisotopic Mass | 267.21983 |
| SMILES | [H][C@@]12CCCN1C/C(=C\[C@H](C)CCCC)[C@@H](O)[C@]2(C)O |
| InChI | InChI=1S/C16H29NO2/c1-4-5-7-12(2)10-13-11-17-9-6-8-14(17)16(3,19)15(13)18/h10,12,14-15,18-19H,4-9,11H2,1-3H3/b13-10+/t12-,14+,15-,16-/m1/s1 |
| InChIKey | LWXKAVPXEDNHLL-VRUXTKGDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Allopumiliotoxin 267a (CHEBI:182171) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-1,2,3,5,7,8a-hexahydroindolizine-7,8-diol |
| Registry Numbers | Sources |
|---|---|
| CAS:73376-38-2 | ChemIDplus |