EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O8 |
| Net Charge | 0 |
| Average Mass | 346.291 |
| Monoisotopic Mass | 346.06887 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(OC)c1O |
| InChI | InChI=1S/C17H14O8/c1-23-11-3-7(4-12(24-2)14(11)20)17-16(22)15(21)13-9(19)5-8(18)6-10(13)25-17/h3-6,18-20,22H,1-2H3 |
| InChIKey | UZMAPBJVXOGOFT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringetin (CHEBI:18215) has functional parent myricetin (CHEBI:18152) |
| syringetin (CHEBI:18215) has role metabolite (CHEBI:25212) |
| syringetin (CHEBI:18215) has role platelet aggregation inhibitor (CHEBI:50427) |
| syringetin (CHEBI:18215) is a 3'-methoxyflavones (CHEBI:138730) |
| syringetin (CHEBI:18215) is a 3',5'-dimethoxyflavone (CHEBI:138732) |
| syringetin (CHEBI:18215) is a 7-hydroxyflavonol (CHEBI:52267) |
| syringetin (CHEBI:18215) is a dimethoxyflavone (CHEBI:23798) |
| syringetin (CHEBI:18215) is a tetrahydroxyflavone (CHEBI:38684) |
| syringetin (CHEBI:18215) is conjugate acid of syringetin(1−) (CHEBI:58412) |
| Incoming Relation(s) |
| syringetin(1−) (CHEBI:58412) is conjugate base of syringetin (CHEBI:18215) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,5,7,4'-Tetrahydroxy-3',5'-dimethoxyflavone | KEGG COMPOUND |
| 3',5'-O-Dimethylmyricetin | KEGG COMPOUND |
| Syringetin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004767 | KNApSAcK |
| C11620 | KEGG COMPOUND |
| LMPK12112498 | LIPID MAPS |
| Syringetin | Wikipedia |
| SYRINGETIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:344330 | Reaxys |
| CAS:4423-37-4 | KEGG COMPOUND |
| CAS:4423-37-4 | ChemIDplus |
| Citations |
|---|