EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO5 |
| Net Charge | 0 |
| Average Mass | 225.200 |
| Monoisotopic Mass | 225.06372 |
| SMILES | O=C(N[C@H](CO)C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C10H11NO5/c12-5-7(10(15)16)11-9(14)6-3-1-2-4-8(6)13/h1-4,7,12-13H,5H2,(H,11,14)(H,15,16)/t7-/m1/s1 |
| InChIKey | SAEFXOJAEDXDBM-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin B2 (CHEBI:182135) has functional parent N-benzoylglycine (CHEBI:18089) |
| Madurastatin B2 (CHEBI:182135) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| (2R)-3-hydroxy-2-[(2-hydroxybenzoyl)amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9543020 | ChemSpider |