EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O5 |
| Net Charge | 0 |
| Average Mass | 308.334 |
| Monoisotopic Mass | 308.13722 |
| SMILES | NC(CCCCNC(=O)C=Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C15H20N2O5/c16-11(15(21)22)3-1-2-8-17-14(20)7-5-10-4-6-12(18)13(19)9-10/h4-7,9,11,18-19H,1-3,8,16H2,(H,17,20)(H,21,22) |
| InChIKey | WVFMZTORJFNZPK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-6-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]hexanoic acid (CHEBI:182091) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-amino-6-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]hexanoic acid |