EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:182027 - Glycine, N-(carboxymethyl)-N-(2-hydroxyethyl)-, disodium salt
| Formula | C6H9NO5.2Na |
| Net Charge | 0 |
| Average Mass | 221.120 |
| Monoisotopic Mass | 221.02761 |
| SMILES | O=C([O-])CN(CCO)CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H11NO5.2Na/c8-2-1-7(3-5(9)10)4-6(11)12;;/h8H,1-4H2,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | ZTVCAEHRNBOTLI-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glycine, N-(carboxymethyl)-N-(2-hydroxyethyl)-, disodium salt (CHEBI:182027) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| disodium;2-[carboxylatomethyl(2-hydroxyethyl)amino]acetate |