EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2O4 |
| Net Charge | 0 |
| Average Mass | 306.362 |
| Monoisotopic Mass | 306.15796 |
| SMILES | COc1cc(/C=C/C(=O)NCCCCNC(C)=O)ccc1O |
| InChI | InChI=1S/C16H22N2O4/c1-12(19)17-9-3-4-10-18-16(21)8-6-13-5-7-14(20)15(11-13)22-2/h5-8,11,20H,3-4,9-10H2,1-2H3,(H,17,19)(H,18,21)/b8-6+ |
| InChIKey | ZVMGKOAHBAIHLO-SOFGYWHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-N-(4-Acetamidobutyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (CHEBI:181964) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-N-(4-acetamidobutyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 22913014 | ChemSpider |