EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO6 |
| Net Charge | 0 |
| Average Mass | 227.172 |
| Monoisotopic Mass | 227.04299 |
| SMILES | N[C@@H](Cc1ccc(C(=O)O)oc1=O)C(=O)O |
| InChI | InChI=1S/C9H9NO6/c10-5(7(11)12)3-4-1-2-6(8(13)14)16-9(4)15/h1-2,5H,3,10H2,(H,11,12)(H,13,14)/t5-/m0/s1 |
| InChIKey | GHFJNBYZGVNAOV-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stizolobinic acid (CHEBI:181950) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| 5-[(2S)-2-amino-2-carboxyethyl]-6-oxopyran-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:17388-96-4 | ChemIDplus |