EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O8 |
| Net Charge | 0 |
| Average Mass | 306.271 |
| Monoisotopic Mass | 306.10632 |
| SMILES | N[C@H](CCCNC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O8/c12-6(9(17)18)2-1-3-13-7(14)4-11(21,10(19)20)5-8(15)16/h6,21H,1-5,12H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/t6-,11?/m1/s1 |
| InChIKey | FFFKYGCGRTUBJH-TZRNXQDGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delta-Citryl-d-ornithine (CHEBI:181938) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| 2-[2-[[(4R)-4-amino-4-carboxybutyl]amino]-2-oxoethyl]-2-hydroxybutanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C22101 | KEGG COMPOUND |