EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O2 |
| Net Charge | 0 |
| Average Mass | 366.505 |
| Monoisotopic Mass | 366.23073 |
| SMILES | [H][C@@]12c3cccc4nc(C(C)(C)C=C)c(c34)C[C@@]1([H])N(C)C[C@@H](C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C23H30N2O2/c1-7-23(4,5)22-16-11-18-20(15-9-8-10-17(24-22)19(15)16)21(27-14(3)26)13(2)12-25(18)6/h7-10,13,18,20-21,24H,1,11-12H2,2-6H3/t13-,18-,20-,21+/m1/s1 |
| InChIKey | OSICWVVWEXKSBD-NDKINLCJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(6Ar,9R,10S,10aR)-7,9-dimethyl-5-(2-methylbut-3-en-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-yl] acetate (CHEBI:181937) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| [(6aR,9R,10S,10aR)-7,9-dimethyl-5-(2-methylbut-3-en-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-g]quinolin-10-yl] acetate |