EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O12 |
| Net Charge | 0 |
| Average Mass | 484.454 |
| Monoisotopic Mass | 484.15808 |
| SMILES | CC(COC1OC(COC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O)C1(O)COC(=O)C1 |
| InChI | InChI=1S/C22H28O12/c1-11(22(30)7-17(26)33-10-22)8-32-21-20(29)19(28)18(27)15(34-21)9-31-16(25)5-3-12-2-4-13(23)14(24)6-12/h2-6,11,15,18-21,23-24,27-30H,7-10H2,1H3 |
| InChIKey | YNPOIPFNQJKGQJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [3,4,5-Trihydroxy-6-[2-(3-hydroxy-5-oxooxolan-3-yl)propoxy]oxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (CHEBI:181904) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-[2-(3-hydroxy-5-oxooxolan-3-yl)propoxy]oxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |