EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O4 |
| Net Charge | 0 |
| Average Mass | 300.354 |
| Monoisotopic Mass | 300.13616 |
| SMILES | COc1cc2c(c(OC)c1)-c1cc(OC)c(OC)cc1CC2 |
| InChI | InChI=1S/C18H20O4/c1-19-13-7-12-6-5-11-8-15(20-2)16(21-3)10-14(11)18(12)17(9-13)22-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | IQOUQPBWTJSPDL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5,7-Tetramethoxy-9,10-dihydrophenanthrene (CHEBI:181855) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 2,3,5,7-tetramethoxy-9,10-dihydrophenanthrene |
| Manual Xrefs | Databases |
|---|---|
| 21615437 | ChemSpider |