EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O5 |
| Net Charge | 0 |
| Average Mass | 294.347 |
| Monoisotopic Mass | 294.14672 |
| SMILES | COc1cc(/C(C)=C/C(C)CCCC(=O)O)oc(=O)c1C |
| InChI | InChI=1S/C16H22O5/c1-10(6-5-7-15(17)18)8-11(2)13-9-14(20-4)12(3)16(19)21-13/h8-10H,5-7H2,1-4H3,(H,17,18)/b11-8+ |
| InChIKey | HXLDSEPZKLJMIQ-DHZHZOJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumis melo (ncbitaxon:3656) | seed (BTO:0001226) | MetaboLights (MTBLS2993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-7-(4-Methoxy-5-methyl-6-oxopyran-2-yl)-5-methyloct-6-enoic acid (CHEBI:181854) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-7-(4-methoxy-5-methyl-6-oxopyran-2-yl)-5-methyloct-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23550536 | ChemSpider |