EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O2 |
| Net Charge | 0 |
| Average Mass | 416.690 |
| Monoisotopic Mass | 416.36543 |
| SMILES | Cc1c(O)cc2c(c1C)O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h19-22,29H,8-18H2,1-7H3/t21-,22-,28-/m1/s1 |
| InChIKey | QUEDXNHFTDJVIY-DQCZWYHMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Homo sapiens (ncbitaxon:9606) | |||
| breast milk (ENVO:02000031) | PubMed (2388136) | ||
| - | MetaboLights (MTBLS93) | From MetaboLights | |
| - | MetaboLights (MTBLS90) | From MetaboLights | |
| - | MetaboLights (MTBLS124) | From MetaboLights | |
| faeces (UBERON:0001988) | PubMed (22411374) | ||
| blood (UBERON:0000178) | PubMed (17823432) | ||
| - | DOI (10.1038/nbt.2488) | ||
| Jatropha curcas (ncbitaxon:180498) | - | DOI (10.1016/j.indcrop.2014.10.048) | |
| Phaseolus coccineus (ncbitaxon:3886) | leaf (BTO:0000713) | PubMed (18582912) | |
| Salmo salar (ncbitaxon:8030) | - | PubMed (25501796) |
| Roles Classification |
|---|
| Chemical Roles: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-tocopherol (CHEBI:18185) has role algal metabolite (CHEBI:84735) |
| γ-tocopherol (CHEBI:18185) has role food antioxidant (CHEBI:77962) |
| γ-tocopherol (CHEBI:18185) has role plant metabolite (CHEBI:76924) |
| γ-tocopherol (CHEBI:18185) is a tocopherol (CHEBI:27013) |
| γ-tocopherol (CHEBI:18185) is a vitamin E (CHEBI:33234) |
| Incoming Relation(s) |
| 13-hydroxy-γ-tocopherol (CHEBI:84963) has functional parent γ-tocopherol (CHEBI:18185) |
| IUPAC Name |
|---|
| (2R)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| (2R)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| (2R)-3,4-dihydro-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol | ChemIDplus |
| (2R,4'R,8'R)-γ-tocopherol | HMDB |
| 7,8-dimethyltocol | ChEBI |
| E308 | ChEBI |
| (+)-gamma-tocopherol | HMDB |
| UniProt Name | Source |
|---|---|
| γ-tocopherol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 83708 | ChemSpider |
| C00007365 | KNApSAcK |
| C02483 | KEGG COMPOUND |
| DB15394 | DrugBank |
| FDB002431 | FooDB |
| GAMA-TOCOPHEROL | MetaCyc |
| Gamma-Tocopherol | Wikipedia |
| HMDB0001492 | HMDB |
| LMPR02020065 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:93072 | Reaxys |
| CAS:54-28-4 | KEGG COMPOUND |
| CAS:54-28-4 | ChemIDplus |
| Citations |
|---|