EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O5 |
| Net Charge | 0 |
| Average Mass | 462.671 |
| Monoisotopic Mass | 462.33452 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC/C=C(\C)C(=O)OC)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C28H46O5/c1-16(7-6-8-17(2)26(32)33-5)20-9-10-21-25-22(15-24(31)28(20,21)4)27(3)12-11-19(29)13-18(27)14-23(25)30/h8,16,18-25,29-31H,6-7,9-15H2,1-5H3/b17-8+/t16-,18+,19-,20-,21+,22+,23-,24+,25+,27+,28-/m1/s1 |
| InChIKey | SZDHRKMCESZUCV-WKGGVHHNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl-3,7,12-trihydroxycholest-24-ene-26-oate (CHEBI:181796) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| methyl (E,6R)-2-methyl-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4943872 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:144210-47-9 | ChemIDplus |