EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O5 |
| Net Charge | 0 |
| Average Mass | 422.606 |
| Monoisotopic Mass | 422.30322 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])([C@H](O)C[C@]3([H])[C@H](C)CCC(=O)OC)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C25H42O5/c1-14(5-6-21(29)30-4)18-13-20(28)23-22-17(8-10-25(18,23)3)24(2)9-7-16(26)11-15(24)12-19(22)27/h14-20,22-23,26-28H,5-13H2,1-4H3/t14-,15+,16-,17+,18-,19-,20-,22+,23+,24+,25-/m1/s1 |
| InChIKey | GNGSNCPQCZJNBI-VAYFVJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha,7alpha,15beta-Trihydroxy-5beta-cholane-24-oic acid methyl ester (CHEBI:181783) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| methyl (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,15R,17R)-3,7,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| Manual Xrefs | Databases |
|---|---|
| 9904240 | ChemSpider |