EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O10 |
| Net Charge | 0 |
| Average Mass | 478.494 |
| Monoisotopic Mass | 478.18390 |
| SMILES | O=C(CCc1ccc(O)c(O)c1)CC(CCc1ccc(O)c(O)c1)OC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C24H30O10/c25-15(5-1-13-3-7-17(26)19(28)9-13)11-16(6-2-14-4-8-18(27)20(29)10-14)34-24-23(32)22(31)21(30)12-33-24/h3-4,7-10,16,21-24,26-32H,1-2,5-6,11-12H2 |
| InChIKey | AQRNEKDRSXYJIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-Bis(3,4-dihydroxyphenyl)-5-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-3-one (CHEBI:181737) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1,7-bis(3,4-dihydroxyphenyl)-5-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-3-one |