EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O5 |
| Net Charge | 0 |
| Average Mass | 400.475 |
| Monoisotopic Mass | 400.19982 |
| SMILES | COc1ccc2c3c(nc2c1)C1CC2C(CC(O)C(OC)C2C(=O)O)CN1CC3 |
| InChI | InChI=1S/C22H28N2O5/c1-28-12-3-4-13-14-5-6-24-10-11-7-18(25)21(29-2)19(22(26)27)15(11)9-17(24)20(14)23-16(13)8-12/h3-4,8,11,15,17-19,21,23,25H,5-7,9-10H2,1-2H3,(H,26,27) |
| InChIKey | JVHNBFFHWQQPLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-Hydroxy-11,17-dimethoxyyohimban-16-carboxylic acid (CHEBI:181717) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 17-hydroxy-6,18-dimethoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 371595 | ChemSpider |