EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)[C@H](O)C(=O)O |
| InChI | InChI=1S/C20H40O3/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(21)20(22)23/h15-19,21H,6-14H2,1-5H3,(H,22,23)/t16?,17?,18?,19-/m0/s1 |
| InChIKey | CGKMKXBKVBXUGK-LFVBFMBRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) has functional parent hexadecanoate (CHEBI:7896) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) has functional parent hexadecanoic acid (CHEBI:15756) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) is a 2-hydroxy fatty acid (CHEBI:10283) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) is a isoprenoid (CHEBI:24913) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) is a long-chain fatty acid (CHEBI:15904) |
| (2S)-2-hydroxyphytanic acid (CHEBI:18164) is conjugate acid of (2S)-2-hydroxyphytanate (CHEBI:58398) |
| Incoming Relation(s) |
| (2S)-2-hydroxyphytanate (CHEBI:58398) is conjugate base of (2S)-2-hydroxyphytanic acid (CHEBI:18164) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3,7,11,15-tetramethylhexadecanoic acid |
| Synonym | Source |
|---|---|
| L-2-hydroxyphytanic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02982 | KEGG COMPOUND |
| Citations |
|---|