EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O5 |
| Net Charge | 0 |
| Average Mass | 240.255 |
| Monoisotopic Mass | 240.09977 |
| SMILES | COc1cc(OC)c(OC)cc1CCC(=O)O |
| InChI | InChI=1S/C12H16O5/c1-15-9-7-11(17-3)10(16-2)6-8(9)4-5-12(13)14/h6-7H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | UGHPWKLKDZLPNM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2,4,5-Trimethoxy-phenyl)-propionic acid (CHEBI:181618) is a benzenes (CHEBI:22712) |
| 3-(2,4,5-Trimethoxy-phenyl)-propionic acid (CHEBI:181618) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(2,4,5-trimethoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24144229 | ChemSpider |