EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO4 |
| Net Charge | 0 |
| Average Mass | 341.407 |
| Monoisotopic Mass | 341.16271 |
| SMILES | [H][C@]12Cc3cc(OC)c(OC)cc3-c3c(OC)c(OC)cc(c31)CCN2 |
| InChI | InChI=1S/C20H23NO4/c1-22-15-9-12-7-14-18-11(5-6-21-14)8-17(24-3)20(25-4)19(18)13(12)10-16(15)23-2/h8-10,14,21H,5-7H2,1-4H3/t14-/m0/s1 |
| InChIKey | MZSUVQFIWWXTFR-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norglaucin (CHEBI:181571) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| (6aS)-1,2,9,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| Manual Xrefs | Databases |
|---|---|
| 28608 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:21848-62-4 | ChemIDplus |