EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44O5 |
| Net Charge | 0 |
| Average Mass | 400.600 |
| Monoisotopic Mass | 400.31887 |
| SMILES | CCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C23H44O5/c1-3-5-7-9-11-13-15-17-22(25)27-20-21(19-24)28-23(26)18-16-14-12-10-8-6-4-2/h21,24H,3-20H2,1-2H3/t21-/m0/s1 |
| InChIKey | GNSDEDOVXZDMKM-NRFANRHFSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-1,2-didecanoylglycerol (CHEBI:18155) is a 1,2-diacyl-sn-glycerol (CHEBI:17815) |
| (S)-1,2-didecanoylglycerol (CHEBI:18155) is a 1,2-didecanoylglycerol (CHEBI:11152) |
| (S)-1,2-didecanoylglycerol (CHEBI:18155) is enantiomer of (R)-1,2-didecanoylglycerol (CHEBI:49181) |
| Incoming Relation(s) |
| (R)-1,2-didecanoylglycerol (CHEBI:49181) is enantiomer of (S)-1,2-didecanoylglycerol (CHEBI:18155) |
| IUPAC Name |
|---|
| (2S)-3-hydroxypropane-1,2-diyl didecanoate |
| Synonyms | Source |
|---|---|
| 1,2-Didecanoylglycerol | KEGG COMPOUND |
| 1,2-Didecanoyl-sn-glycerol | KEGG COMPOUND |
| 1,2-di-O-decanoylglycerol | JCBN |
| sn-1,2-didecanoylglycerol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,2-didecanoyl-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03199 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1715874 | Beilstein |
| CAS:60514-49-0 | ChemIDplus |