EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O6 |
| Net Charge | 0 |
| Average Mass | 388.460 |
| Monoisotopic Mass | 388.18859 |
| SMILES | COc1c(O)cc2c(c1OC)-c1c(cc(O)c(OC)c1OC)CC(C)C(C)C2 |
| InChI | InChI=1S/C22H28O6/c1-11-7-13-9-15(23)19(25-3)21(27-5)17(13)18-14(8-12(11)2)10-16(24)20(26-4)22(18)28-6/h9-12,23-24H,7-8H2,1-6H3 |
| InChIKey | PICOUNAPKDEPCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,11,12-Tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrodibenzo[a,c][8]annulene-3,10-diol (CHEBI:181529) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 3,4,15,16-tetramethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-5,14-diol |
| Manual Xrefs | Databases |
|---|---|
| 65928 | ChemSpider |