EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O4 |
| Net Charge | 0 |
| Average Mass | 172.180 |
| Monoisotopic Mass | 172.07356 |
| SMILES | C/C=C/C(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C8H12O4/c1-2-3-6(4-7(9)10)5-8(11)12/h2-3,6H,4-5H2,1H3,(H,9,10)(H,11,12)/b3-2+ |
| InChIKey | MZNNPGRTALKBID-NSCUHMNNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(E)-Prop-1-enyl]pentanedioic acid (CHEBI:181520) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 3-[(E)-prop-1-enyl]pentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 29814870 | ChemSpider |