EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N3O4 |
| Net Charge | 0 |
| Average Mass | 293.323 |
| Monoisotopic Mass | 293.13756 |
| SMILES | NC(=O)NCCCC(NC(=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19N3O4/c15-14(21)16-8-4-7-11(13(19)20)17-12(18)9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,17,18)(H,19,20)(H3,15,16,21) |
| InChIKey | FTYZUGZNDHQHFV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(carbamoylamino)-2-[(2-phenylacetyl)amino]pentanoic acid (CHEBI:181495) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 5-(carbamoylamino)-2-[(2-phenylacetyl)amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29814866 | ChemSpider |