EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO5 |
| Net Charge | 0 |
| Average Mass | 327.336 |
| Monoisotopic Mass | 327.11067 |
| SMILES | COC1CC23C(=CC(=O)N2CCc2cc4c(cc23)OCO4)C2OC12 |
| InChI | InChI=1S/C18H17NO5/c1-21-14-7-18-10-5-13-12(22-8-23-13)4-9(10)2-3-19(18)15(20)6-11(18)16-17(14)24-16/h4-6,14,16-17H,2-3,7-8H2,1H3 |
| InChIKey | WQOZASFQHLTUGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Oxoerythraline_epoxide (CHEBI:181464) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 20-methoxy-5,7,18-trioxa-13-azahexacyclo[11.8.0.01,16.02,10.04,8.017,19]henicosa-2,4(8),9,15-tetraen-14-one |