EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H45N5O5 |
| Net Charge | 0 |
| Average Mass | 591.753 |
| Monoisotopic Mass | 591.34207 |
| SMILES | CCC(C)(C)C1C(=O)N2CCCC2C2(O)OC(NC(=O)C3CC4c5cccc6ncc(c56)CC4N(C)C3)(C(C)C)C(=O)N12 |
| InChI | InChI=1S/C33H45N5O5/c1-7-31(4,5)27-29(40)37-13-9-12-25(37)33(42)38(27)30(41)32(43-33,18(2)3)35-28(39)20-14-22-21-10-8-11-23-26(21)19(16-34-23)15-24(22)36(6)17-20/h8,10-11,16,18,20,22,24-25,27,34,42H,7,9,12-15,17H2,1-6H3,(H,35,39) |
| InChIKey | YLXBZBPHTNJZQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alkergot (CHEBI:181460) is a peptide ergot alkaloid (CHEBI:25904) |
| IUPAC Name |
|---|
| N-[2-hydroxy-7-(2-methylbutan-2-yl)-5,8-dioxo-4-propan-2-yl-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 515264 | ChemSpider |