EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C7H7NO3/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,9H,8H2,(H,10,11) |
| InChIKey | HYNQTSZBTIOFKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-5-hydroxybenzoic acid (CHEBI:181437) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-amino-5-hydroxybenzoic acid |