EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O4.HCl |
| Net Charge | 0 |
| Average Mass | 432.948 |
| Monoisotopic Mass | 432.18159 |
| SMILES | CN(C)CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.Cl |
| InChI | InChI=1S/C23H28N2O4.ClH/c1-25(2)14-8-7-13-21(22(26)27)24-23(28)29-15-20-18-11-5-3-9-16(18)17-10-4-6-12-19(17)20;/h3-6,9-12,20-21H,7-8,13-15H2,1-2H3,(H,24,28)(H,26,27);1H/t21-;/m0./s1 |
| InChIKey | SJFAFKDBWNFBCC-BOXHHOBZSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fmoc-lys(ME)2-OH hcl (CHEBI:181426) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (2S)-6-(dimethylamino)-2-(9H-luoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride |
| Manual Xrefs | Databases |
|---|---|
| 24723577 | ChemSpider |