EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O5 |
| Net Charge | 0 |
| Average Mass | 217.181 |
| Monoisotopic Mass | 217.06987 |
| SMILES | NC(=O)C1OC1C(=O)NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H11N3O5/c8-2(7(13)14)1-10-6(12)4-3(15-4)5(9)11/h2-4H,1,8H2,(H2,9,11)(H,10,12)(H,13,14)/t2-,3?,4?/m0/s1 |
| InChIKey | LQRXQGMIBGPNBY-WXJVFSNFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-3-(3-Carbamoyloxiranylcarbonylamino)-2-aminopropanoic acid (CHEBI:181411) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[(3-carbamoyloxirane-2-carbonyl)amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C20967 | KEGG COMPOUND |