EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O6 |
| Net Charge | 0 |
| Average Mass | 258.230 |
| Monoisotopic Mass | 258.08519 |
| SMILES | C#C[C@@H](O)[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14N2O6/c1-2-6(13)8(10(17)18)12-7(14)4-3-5(11)9(15)16/h1,5-6,8,13H,3-4,11H2,(H,12,14)(H,15,16)(H,17,18)/t5-,6+,8-/m0/s1 |
| InChIKey | KTLVUFLBLWWBNE-BBVRLYRLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-Amino-5-[[(1S,2R)-1-carboxy-2-hydroxybut-3-ynyl]amino]-5-oxopentanoic acid (CHEBI:181399) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(1S,2R)-1-carboxy-2-hydroxybut-3-ynyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C22140 | KEGG COMPOUND |