EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O6 |
| Net Charge | 0 |
| Average Mass | 306.314 |
| Monoisotopic Mass | 306.11034 |
| SMILES | COc1c(OC(C)C)cc2cc(O)c(C(=O)O)cc2c1OC |
| InChI | InChI=1S/C16H18O6/c1-8(2)22-13-6-9-5-12(17)11(16(18)19)7-10(9)14(20-3)15(13)21-4/h5-8,17H,1-4H3,(H,18,19) |
| InChIKey | ZGJVTOWBZYBXKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxy-7,8-dimethoxy-6-isopropoxy-2-naphthoate (CHEBI:181393) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 3-hydroxy-7,8-dimethoxy-6-propan-2-yloxynaphthalene-2-carboxylic acid |