EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O6 |
| Net Charge | 0 |
| Average Mass | 346.339 |
| Monoisotopic Mass | 346.11649 |
| SMILES | O=C(O)C1=C/C(=C/C=[NH+]/CCc2ccc(O)c(O)c2)CC(C(=O)[O-])N1 |
| InChI | InChI=1S/C17H18N2O6/c20-14-2-1-10(9-15(14)21)3-5-18-6-4-11-7-12(16(22)23)19-13(8-11)17(24)25/h1-2,4,6-7,9,13,19-21H,3,5,8H2,(H,22,23)(H,24,25)/b11-4-,18-6+ |
| InChIKey | PDKFHZWVCCZUIF-HJZIUTPASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4E)-6-Carboxy-4-[2-[2-(3,4-dihydroxyphenyl)ethylazaniumylidene]ethylidene]-2,3-dihydro-1H-pyridine-2-carboxylate (CHEBI:181390) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (4E)-6-carboxy-4-[2-[2-(3,4-dihydroxyphenyl)ethylazaniumylidene]ethylidene]-2,3-dihydro-1H-pyridine-2-carboxylate |