EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:181385 - (1R,2S,4R,8S,9S,12R)-2-Formyl-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-4-carboxylic acid
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@]12CC[C@]3([H])[C@](CC1=C)(C2)[C@@H](C=O)C1[C@](C)(C(=O)O)CCC[C@]13C |
| InChI | InChI=1S/C20H28O3/c1-12-9-20-10-13(12)5-6-15(20)18(2)7-4-8-19(3,17(22)23)16(18)14(20)11-21/h11,13-16H,1,4-10H2,2-3H3,(H,22,23)/t13-,14+,15+,16?,18+,19-,20-/m1/s1 |
| InChIKey | ZCTUNYRXJKLWPY-YBNSQJHGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2S,4R,8S,9S,12R)-2-Formyl-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-4-carboxylic acid (CHEBI:181385) is a C20-gibberellin (CHEBI:20859) |
| IUPAC Name |
|---|
| (1R,2S,4R,8S,9S,12R)-2-ormyl-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 389743 | ChemSpider |
| C06093 | KEGG COMPOUND |
| LMPR01040066 | LIPID MAPS |