EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O2 |
| Net Charge | 0 |
| Average Mass | 324.424 |
| Monoisotopic Mass | 324.18378 |
| SMILES | [H][C@@]12CCN(C[C@@H]1C=C)[C@@H](C(O)c1ccnc3ccc(OC)cc13)C2 |
| InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19+,20?/m0/s1 |
| InChIKey | LOUPRKONTZGTKE-USWSZDBUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CHEBI:181257) is a cinchona alkaloid (CHEBI:51323) |
| IUPAC Name |
|---|
| [(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| Manual Xrefs | Databases |
|---|---|
| 19952933 | ChemSpider |