EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | O=C(CCc1ccc(O)c(O)c1)CCC(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H22O6/c20-14(4-1-12-2-7-16(22)18(24)10-12)5-6-15(21)9-13-3-8-17(23)19(25)11-13/h2-3,7-8,10-11,15,21-25H,1,4-6,9H2 |
| InChIKey | NOFGKTVEZONBCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-Bis(3,4-dihydroxyphenyl)-6-hydroxyheptan-3-one (CHEBI:181241) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1,7-bis(3,4-dihydroxyphenyl)-6-hydroxyheptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 22936677 | ChemSpider |