EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O |
| Net Charge | 0 |
| Average Mass | 264.368 |
| Monoisotopic Mass | 264.15142 |
| SMILES | O=C(C=CCCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-6,8-12,14H,7,13,15-16H2 |
| InChIKey | UDNMYDZHPMNIEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hepten-3-one, 1,7-diphenyl- (CHEBI:181206) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1,7-diphenylhept-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 57573389 | ChemSpider |