EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O3 |
| Net Charge | 0 |
| Average Mass | 420.678 |
| Monoisotopic Mass | 420.36035 |
| SMILES | [H][C@]12C[C@@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O3/c1-17(16-28)6-5-7-18(2)21-8-9-22-25-23(11-13-27(21,22)4)26(3)12-10-20(29)14-19(26)15-24(25)30/h17-25,28-30H,5-16H2,1-4H3/t17?,18-,19-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
| InChIKey | OQIJRBFRXGIHMI-KZBWLCAVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Cholestane-3beta,7alpha,26-triol (CHEBI:181196) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3S,5R,7R,8R,9S,10S,13R,14S,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 4447278 | ChemSpider |
| LMST04030011 | LIPID MAPS |