EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O5 |
| Net Charge | 0 |
| Average Mass | 252.266 |
| Monoisotopic Mass | 252.09977 |
| SMILES | COC(=O)C=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16O5/c1-15-10-7-9(5-6-12(14)17-3)8-11(16-2)13(10)18-4/h5-8H,1-4H3 |
| InChIKey | KLXHCGFNNUQTEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (CHEBI:181127) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| methyl 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 128835 | ChemSpider |