EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O2 |
| Net Charge | 0 |
| Average Mass | 322.408 |
| Monoisotopic Mass | 322.16813 |
| SMILES | C=CC12CN(C)C3C4COC(CC41)C1(C(=O)Nc4ccccc41)C32 |
| InChI | InChI=1S/C20H22N2O2/c1-3-19-10-22(2)16-11-9-24-15(8-13(11)19)20(17(16)19)12-6-4-5-7-14(12)21-18(20)23/h3-7,11,13,15-17H,1,8-10H2,2H3,(H,21,23) |
| InChIKey | NFYYATWFXNPTRM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gelsemin (CHEBI:181110) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| 2'-ethenyl-4'-methylspiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2-one |
| Manual Xrefs | Databases |
|---|---|
| 245682 | ChemSpider |