EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29NO4 |
| Net Charge | 0 |
| Average Mass | 287.400 |
| Monoisotopic Mass | 287.20966 |
| SMILES | CCCCCCCC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C15H29NO4/c1-5-6-7-8-9-10-15(19)20-13(11-14(17)18)12-16(2,3)4/h13H,5-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | CXTATJFJDMJMIY-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-octanoyl-L-carnitine (CHEBI:18102) has role human metabolite (CHEBI:77746) |
| O-octanoyl-L-carnitine (CHEBI:18102) is a O-octanoylcarnitine (CHEBI:73039) |
| O-octanoyl-L-carnitine (CHEBI:18102) is a medium-chain fatty acyl-L-carnitine (CHEBI:229628) |
| O-octanoyl-L-carnitine (CHEBI:18102) is a saturated fatty acyl-L-carnitine (CHEBI:133445) |
| O-octanoyl-L-carnitine (CHEBI:18102) is enantiomer of O-octanoyl-D-carnitine (CHEBI:86051) |
| Incoming Relation(s) |
| octanoyl-L-carnitine-d3 (CHEBI:192247) is a O-octanoyl-L-carnitine (CHEBI:18102) |
| O-octanoyl-D-carnitine (CHEBI:86051) is enantiomer of O-octanoyl-L-carnitine (CHEBI:18102) |
| IUPAC Name |
|---|
| (3R)-3-octanoyloxy-4-(trimethylammonio)butanoate |
| Synonyms | Source |
|---|---|
| O-octanoyl-R-carnitine | LIPID MAPS |
| L-Octanoylcarnitine | KEGG COMPOUND |
| L-octanoyl-L-carnitine | ChEBI |
| UniProt Name | Source |
|---|---|
| O-octanoyl-(R)-carnitine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02838 | KEGG COMPOUND |
| HMDB0000791 | HMDB |
| LMFA07070002 | LIPID MAPS |
| L-OCTANOYLCARNITINE | MetaCyc |
| OCB | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:25243-95-2 | HMDB |
| Citations |
|---|