EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35NO2 |
| Net Charge | 0 |
| Average Mass | 333.516 |
| Monoisotopic Mass | 333.26678 |
| SMILES | CCC(C)CC(C)/C=C/CCC(O)C(Cc1ccc(O)cc1)NC |
| InChI | InChI=1S/C21H35NO2/c1-5-16(2)14-17(3)8-6-7-9-21(24)20(22-4)15-18-10-12-19(23)13-11-18/h6,8,10-13,16-17,20-24H,5,7,9,14-15H2,1-4H3/b8-6+ |
| InChIKey | RNCWKUCWPBNWOH-SOFGYWHQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(E)-3-Hydroxy-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol (CHEBI:181013) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 4-[(E)-3-hydroxy-8,10-dimethyl-2-(methylamino)dodec-6-enyl]phenol |
| Manual Xrefs | Databases |
|---|---|
| 22912674 | ChemSpider |