EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:180996 - 6-Chloronicotinic acid
| Formula | C6H4ClNO2 |
| Net Charge | 0 |
| Average Mass | 157.556 |
| Monoisotopic Mass | 156.99306 |
| SMILES | O=C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10) |
| InChIKey | UAWMVMPAYRWUFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Chloronicotinic acid (CHEBI:180996) is a aromatic carboxylic acid (CHEBI:33859) |
| 6-Chloronicotinic acid (CHEBI:180996) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 6-chloropyridine-3-carboxylic acid |