EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12 |
| Net Charge | 0 |
| Average Mass | 180.250 |
| Monoisotopic Mass | 180.09390 |
| SMILES | Cc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C14H12/c1-10-5-4-8-13-12-7-3-2-6-11(12)9-14(10)13/h2-8H,9H2,1H3 |
| InChIKey | GKEUODMJRFDLJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Methylfluorene (CHEBI:180972) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 1-methyl-9H-luorene |