EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)/C(=C\C)C(=O)C[C@@]21[H] |
| InChI | InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4-/t15-,17+,18+,20+,21-/m1/s1 |
| InChIKey | WDXRGPWQVHZTQJ-AUKWTSKRSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| E-Guggulsterone (CHEBI:180961) has role androgen (CHEBI:50113) |
| E-Guggulsterone (CHEBI:180961) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (8R,9S,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione |
| Registry Numbers | Sources |
|---|---|
| CAS:39025-24-6 | ChemIDplus |